C23H23BrO2 — CID 122229752
2-[(2-bromophenyl)-(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol (PubChem CID 122229752) has the molecular formula C23H23BrO2 and a molecular weight of 411.34 g/mol. Its IUPAC name is 2-[(2-bromophenyl)-(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol.
| Compound Name | 2-[(2-bromophenyl)-(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 122229752 |
| Molecular Formula | C23H23BrO2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[(2-bromophenyl)-(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(c2ccccc2Br)c2cc(C)cc(C)c2O)c1 |
| InChI | InChI=1S/C23H23BrO2/c1-13-9-15(3)22(25)18(11-13)21(17-7-5-6-8-20(17)24)19-12-14(2)10-16(4)23(19)26/h5-12,21,25-26H,1-4H3 |
| InChIKey | GISHLZANBSXWPX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|