C35H47BrO2 — CID 177499122
2-[(2-bromophenyl)-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol (PubChem CID 177499122) has the molecular formula C35H47BrO2 and a molecular weight of 579.66 g/mol. Its IUPAC name is 2-[(2-bromophenyl)-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(2-bromophenyl)-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 177499122 |
| Molecular Formula | C35H47BrO2 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | 2-[(2-bromophenyl)-(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C(c2ccccc2Br)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H47BrO2/c1-32(2,3)21-17-24(30(37)26(19-21)34(7,8)9)29(23-15-13-14-16-28(23)36)25-18-22(33(4,5)6)20-27(31(25)38)35(10,11)12/h13-20,29,37-38H,1-12H3 |
| InChIKey | HLZDMHFCVGKRPA-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|