C23H24O3 — CID 66868185
2,6-bis[1-(2-hydroxyphenyl)ethyl]-4-methylphenol (PubChem CID 66868185) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2,6-bis[1-(2-hydroxyphenyl)ethyl]-4-methylphenol.
| Compound Name | 2,6-bis[1-(2-hydroxyphenyl)ethyl]-4-methylphenol |
|---|---|
| PubChem CID | 66868185 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2,6-bis[1-(2-hydroxyphenyl)ethyl]-4-methylphenol |
| SMILES | Cc1cc(C(C)c2ccccc2O)c(O)c(C(C)c2ccccc2O)c1 |
| InChI | InChI=1S/C23H24O3/c1-14-12-19(15(2)17-8-4-6-10-21(17)24)23(26)20(13-14)16(3)18-9-5-7-11-22(18)25/h4-13,15-16,24-26H,1-3H3 |
| InChIKey | FLOYTFHQGVFPRS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |