About 6,8-dimethylphenazin-1-ol
6,8-dimethylphenazin-1-ol (PubChem CID 137281639) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 6,8-dimethylphenazin-1-ol.
Molecular Properties
| Compound Name | 6,8-dimethylphenazin-1-ol |
| PubChem CID | 137281639 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 6,8-dimethylphenazin-1-ol |
| SMILES | Cc1cc(C)c2nc3cccc(O)c3nc2c1 |
| InChI | InChI=1S/C14H12N2O/c1-8-6-9(2)13-11(7-8)16-14-10(15-13)4-3-5-12(14)17/h3-7,17H,1-2H3 |
| InChIKey | GUENWLAUFPVWMF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dimethylphenazin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethylphenazin-1-ol?
The IUPAC name of 6,8-dimethylphenazin-1-ol (CID 137281639) is 6,8-dimethylphenazin-1-ol.
What is the SMILES notation for 6,8-dimethylphenazin-1-ol?
The canonical SMILES for 6,8-dimethylphenazin-1-ol is Cc1cc(C)c2nc3cccc(O)c3nc2c1.
What is the InChIKey of 6,8-dimethylphenazin-1-ol?
The InChIKey is GUENWLAUFPVWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-8-6-9(2)13-11(7-8)16-14-10(15-13)4-3-5-12(14)17/h3-7,17H,1-2H3.
What are the key properties of 6,8-dimethylphenazin-1-ol?
6,8-dimethylphenazin-1-ol has a molecular weight of 224.26 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethylphenazin-1-ol is sourced from PubChem (CID 137281639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).