About 8-methoxyphenazin-1-ol
8-methoxyphenazin-1-ol (PubChem CID 138967481) has the molecular formula C13H10N2O2
and a molecular weight of 226.23 g/mol. Its IUPAC name is 8-methoxyphenazin-1-ol.
Molecular Properties
| Compound Name | 8-methoxyphenazin-1-ol |
| PubChem CID | 138967481 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 8-methoxyphenazin-1-ol |
| SMILES | COc1ccc2nc3cccc(O)c3nc2c1 |
| InChI | InChI=1S/C13H10N2O2/c1-17-8-5-6-9-11(7-8)15-13-10(14-9)3-2-4-12(13)16/h2-7,16H,1H3 |
| InChIKey | MJXIKBPQQBMBSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxyphenazin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxyphenazin-1-ol?
The IUPAC name of 8-methoxyphenazin-1-ol (CID 138967481) is 8-methoxyphenazin-1-ol.
What is the SMILES notation for 8-methoxyphenazin-1-ol?
The canonical SMILES for 8-methoxyphenazin-1-ol is COc1ccc2nc3cccc(O)c3nc2c1.
What is the InChIKey of 8-methoxyphenazin-1-ol?
The InChIKey is MJXIKBPQQBMBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2/c1-17-8-5-6-9-11(7-8)15-13-10(14-9)3-2-4-12(13)16/h2-7,16H,1H3.
What are the key properties of 8-methoxyphenazin-1-ol?
8-methoxyphenazin-1-ol has a molecular weight of 226.23 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxyphenazin-1-ol is sourced from PubChem (CID 138967481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).