C11H8N2O3 — CID 146025256
5-methoxycyclobuta[b]quinoxaline-1,2-diol (PubChem CID 146025256) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 5-methoxycyclobuta[b]quinoxaline-1,2-diol.
| Compound Name | 5-methoxycyclobuta[b]quinoxaline-1,2-diol |
|---|---|
| PubChem CID | 146025256 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-methoxycyclobuta[b]quinoxaline-1,2-diol |
| SMILES | COc1ccc2nc3c(nc2c1)C(O)=C3O |
| InChI | InChI=1S/C11H8N2O3/c1-16-5-2-3-6-7(4-5)13-9-8(12-6)10(14)11(9)15/h2-4,14-15H,1H3 |
| InChIKey | IOTIMHNVONPJDF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |