C10H5FN2O2 — CID 135502848
5-fluorocyclobuta[b]quinoxaline-1,2-diol (PubChem CID 135502848) has the molecular formula C10H5FN2O2 and a molecular weight of 204.16 g/mol. Its IUPAC name is 5-fluorocyclobuta[b]quinoxaline-1,2-diol.
| Compound Name | 5-fluorocyclobuta[b]quinoxaline-1,2-diol |
|---|---|
| PubChem CID | 135502848 |
| Molecular Formula | C10H5FN2O2 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 5-fluorocyclobuta[b]quinoxaline-1,2-diol |
| SMILES | OC1=C(O)c2nc3cc(F)ccc3nc21 |
| InChI | InChI=1S/C10H5FN2O2/c11-4-1-2-5-6(3-4)13-8-7(12-5)9(14)10(8)15/h1-3,14-15H |
| InChIKey | PTBHOKXSPZHBPB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |