C15H7FN2O — CID 122192565
7-fluoroindeno[1,2-b]quinoxalin-11-one (PubChem CID 122192565) has the molecular formula C15H7FN2O and a molecular weight of 250.23 g/mol. Its IUPAC name is 7-fluoroindeno[1,2-b]quinoxalin-11-one.
| Compound Name | 7-fluoroindeno[1,2-b]quinoxalin-11-one |
|---|---|
| PubChem CID | 122192565 |
| Molecular Formula | C15H7FN2O |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 7-fluoroindeno[1,2-b]quinoxalin-11-one |
| SMILES | O=C1c2ccccc2-c2nc3cc(F)ccc3nc21 |
| InChI | InChI=1S/C15H7FN2O/c16-8-5-6-11-12(7-8)18-13-9-3-1-2-4-10(9)15(19)14(13)17-11/h1-7H |
| InChIKey | FOUZJQBJLIRKRV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |