C18H10N2O4 — CID 90240452
methyl 5,6-dioxobenzo[a]phenazine-9-carboxylate (PubChem CID 90240452) has the molecular formula C18H10N2O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is methyl 5,6-dioxobenzo[a]phenazine-9-carboxylate.
| Compound Name | methyl 5,6-dioxobenzo[a]phenazine-9-carboxylate |
|---|---|
| PubChem CID | 90240452 |
| Molecular Formula | C18H10N2O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | methyl 5,6-dioxobenzo[a]phenazine-9-carboxylate |
| SMILES | COC(=O)c1ccc2nc3c(nc2c1)C(=O)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C18H10N2O4/c1-24-18(23)9-6-7-12-13(8-9)20-15-14(19-12)10-4-2-3-5-11(10)16(21)17(15)22/h2-8H,1H3 |
| InChIKey | DZZDLIMYTPGQBN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|