C26H20N2O6 — CID 135017130
methyl 2,3-bis(2-acetyloxyphenyl)quinoxaline-6-carboxylate (PubChem CID 135017130) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is methyl 2,3-bis(2-acetyloxyphenyl)quinoxaline-6-carboxylate.
| Compound Name | methyl 2,3-bis(2-acetyloxyphenyl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 135017130 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | methyl 2,3-bis(2-acetyloxyphenyl)quinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3ccccc3OC(C)=O)c(-c3ccccc3OC(C)=O)nc2c1 |
| InChI | InChI=1S/C26H20N2O6/c1-15(29)33-22-10-6-4-8-18(22)24-25(19-9-5-7-11-23(19)34-16(2)30)28-21-14-17(26(31)32-3)12-13-20(21)27-24/h4-14H,1-3H3 |
| InChIKey | URZKXFFFJYBALH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|