C21H18N2O6 — CID 9456451
dimethyl 5-(2,3-dimethylquinoxaline-6-carbonyl)oxybenzene-1,3-dicarboxylate (PubChem CID 9456451) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is dimethyl 5-(2,3-dimethylquinoxaline-6-carbonyl)oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(2,3-dimethylquinoxaline-6-carbonyl)oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9456451 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | dimethyl 5-(2,3-dimethylquinoxaline-6-carbonyl)oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)c2ccc3nc(C)c(C)nc3c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H18N2O6/c1-11-12(2)23-18-10-13(5-6-17(18)22-11)21(26)29-16-8-14(19(24)27-3)7-15(9-16)20(25)28-4/h5-10H,1-4H3 |
| InChIKey | GQKRQILRXHLWKV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|