C19H18N2O2 — CID 9192017
(2,6-dimethylphenyl) 2,3-dimethylquinoxaline-6-carboxylate (PubChem CID 9192017) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2,3-dimethylquinoxaline-6-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 2,3-dimethylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 9192017 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2,6-dimethylphenyl) 2,3-dimethylquinoxaline-6-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)c1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C19H18N2O2/c1-11-6-5-7-12(2)18(11)23-19(22)15-8-9-16-17(10-15)21-14(4)13(3)20-16/h5-10H,1-4H3 |
| InChIKey | KQFFQCYWULPJPN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|