C18H15ClN2O2 — CID 6459752
(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate (PubChem CID 6459752) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 6459752 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate |
| SMILES | Cc1nc2ccc(C(=O)OCc3ccc(Cl)cc3)cc2nc1C |
| InChI | InChI=1S/C18H15ClN2O2/c1-11-12(2)21-17-9-14(5-8-16(17)20-11)18(22)23-10-13-3-6-15(19)7-4-13/h3-9H,10H2,1-2H3 |
| InChIKey | SMDOXOQJPGNBFT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |