(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate

C18H15ClN2O2 — CID 6459752

IUPAC(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate
SMILESCc1nc2ccc(C(=O)OCc3ccc(Cl)cc3)cc2nc1C
InChIInChI=1S/C18H15ClN2O2/c1-11-12(2)21-17-9-14(5-8-16(17)20-11)18(22)23-10-13-3-6-15(19)7-4-13/h3-9H,10H2,1-2H3
InChIKeySMDOXOQJPGNBFT-UHFFFAOYSA-N
MW326.78 g/mol
LogP4.26
Rot. Bonds3

About (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate

(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate (PubChem CID 6459752) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate
PubChem CID6459752
Molecular FormulaC18H15ClN2O2
Molecular Weight326.78 g/mol
Exact Mass326.08
IUPAC Name(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate
SMILESCc1nc2ccc(C(=O)OCc3ccc(Cl)cc3)cc2nc1C
InChIInChI=1S/C18H15ClN2O2/c1-11-12(2)21-17-9-14(5-8-16(17)20-11)18(22)23-10-13-3-6-15(19)7-4-13/h3-9H,10H2,1-2H3
InChIKeySMDOXOQJPGNBFT-UHFFFAOYSA-N
XLogP4.26
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.78
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate?
The IUPAC name of (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate (CID 6459752) is (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate.
What is the SMILES notation for (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate?
The canonical SMILES for (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate is Cc1nc2ccc(C(=O)OCc3ccc(Cl)cc3)cc2nc1C.
What is the InChIKey of (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate?
The InChIKey is SMDOXOQJPGNBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O2/c1-11-12(2)21-17-9-14(5-8-16(17)20-11)18(22)23-10-13-3-6-15(19)7-4-13/h3-9H,10H2,1-2H3.
What are the key properties of (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate?
(4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate has a molecular weight of 326.78 g/mol, XLogP of 4.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate is sourced from PubChem (CID 6459752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).