C17H12F2N2O2 — CID 18194516
(3-methylquinoxalin-2-yl)methyl 3,4-difluorobenzoate (PubChem CID 18194516) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is (3-methylquinoxalin-2-yl)methyl 3,4-difluorobenzoate.
| Compound Name | (3-methylquinoxalin-2-yl)methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 18194516 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (3-methylquinoxalin-2-yl)methyl 3,4-difluorobenzoate |
| SMILES | Cc1nc2ccccc2nc1COC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12F2N2O2/c1-10-16(21-15-5-3-2-4-14(15)20-10)9-23-17(22)11-6-7-12(18)13(19)8-11/h2-8H,9H2,1H3 |
| InChIKey | GZZPXQZZGOFOMH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |