C27H21N5O4 — CID 46795021
bis[(3-methylquinoxalin-2-yl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 46795021) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is bis[(3-methylquinoxalin-2-yl)methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(3-methylquinoxalin-2-yl)methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 46795021 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | bis[(3-methylquinoxalin-2-yl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | Cc1nc2ccccc2nc1COC(=O)c1cccc(C(=O)OCc2nc3ccccc3nc2C)n1 |
| InChI | InChI=1S/C27H21N5O4/c1-16-24(30-20-10-5-3-8-18(20)28-16)14-35-26(33)22-12-7-13-23(32-22)27(34)36-15-25-17(2)29-19-9-4-6-11-21(19)31-25/h3-13H,14-15H2,1-2H3 |
| InChIKey | UCNJLRUNNYKXTB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 117.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |