C20H19N3O4 — CID 51966253
(3-methylquinoxalin-2-yl)methyl (2R)-2-benzamido-3-hydroxypropanoate (PubChem CID 51966253) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (3-methylquinoxalin-2-yl)methyl (2R)-2-benzamido-3-hydroxypropanoate.
| Compound Name | (3-methylquinoxalin-2-yl)methyl (2R)-2-benzamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 51966253 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (3-methylquinoxalin-2-yl)methyl (2R)-2-benzamido-3-hydroxypropanoate |
| SMILES | Cc1nc2ccccc2nc1COC(=O)[C@@H](CO)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O4/c1-13-18(22-16-10-6-5-9-15(16)21-13)12-27-20(26)17(11-24)23-19(25)14-7-3-2-4-8-14/h2-10,17,24H,11-12H2,1H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | LVENQHWGZWTWBO-QGZVFWFLSA-N |
| XLogP | 1.77 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |