C20H19N3O4 — CID 31048252
(3-methyl-1,2,4-oxadiazol-5-yl)methyl (2R)-2-benzamido-3-phenylpropanoate (PubChem CID 31048252) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)methyl (2R)-2-benzamido-3-phenylpropanoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl (2R)-2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 31048252 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl (2R)-2-benzamido-3-phenylpropanoate |
| SMILES | Cc1noc(COC(=O)[C@@H](Cc2ccccc2)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H19N3O4/c1-14-21-18(27-23-14)13-26-20(25)17(12-15-8-4-2-5-9-15)22-19(24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | JBHLLWCDSHLZKE-QGZVFWFLSA-N |
| XLogP | 2.46 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |