C21H19N3O5 — CID 16596743
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 16596743) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 16596743 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1)Nc1ccon1 |
| InChI | InChI=1S/C21H19N3O5/c25-19(23-18-11-12-29-24-18)14-28-21(27)17(13-15-7-3-1-4-8-15)22-20(26)16-9-5-2-6-10-16/h1-12,17H,13-14H2,(H,22,26)(H,23,24,25) |
| InChIKey | CNABWPLIHTUYEX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |