C25H23ClN2O4 — CID 3372467
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 3372467) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 3372467 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C25H23ClN2O4/c26-21-14-8-7-13-20(21)16-27-23(29)17-32-25(31)22(15-18-9-3-1-4-10-18)28-24(30)19-11-5-2-6-12-19/h1-14,22H,15-17H2,(H,27,29)(H,28,30) |
| InChIKey | DBZIDGQXOUCFMT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |