C29H34N2O4 — CID 5185063
[2-(1-adamantylmethylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate (PubChem CID 5185063) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 5185063 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 2-benzamido-3-phenylpropanoate |
| SMILES | O=C(COC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H34N2O4/c32-26(30-19-29-15-21-11-22(16-29)13-23(12-21)17-29)18-35-28(34)25(14-20-7-3-1-4-8-20)31-27(33)24-9-5-2-6-10-24/h1-10,21-23,25H,11-19H2,(H,30,32)(H,31,33) |
| InChIKey | YZTCZJJTGHNIIL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |