C26H30N2O8 — CID 101142290
[(E)-6-[(2S)-2-benzamido-3-hydroxypropanoyl]oxyhex-3-enyl] (2S)-2-benzamido-3-hydroxypropanoate (PubChem CID 101142290) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(E)-6-[(2S)-2-benzamido-3-hydroxypropanoyl]oxyhex-3-enyl] (2S)-2-benzamido-3-hydroxypropanoate.
| Compound Name | [(E)-6-[(2S)-2-benzamido-3-hydroxypropanoyl]oxyhex-3-enyl] (2S)-2-benzamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 101142290 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [(E)-6-[(2S)-2-benzamido-3-hydroxypropanoyl]oxyhex-3-enyl] (2S)-2-benzamido-3-hydroxypropanoate |
| SMILES | O=C(N[C@@H](CO)C(=O)OCC/C=C/CCOC(=O)[C@H](CO)NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O8/c29-17-21(27-23(31)19-11-5-3-6-12-19)25(33)35-15-9-1-2-10-16-36-26(34)22(18-30)28-24(32)20-13-7-4-8-14-20/h1-8,11-14,21-22,29-30H,9-10,15-18H2,(H,27,31)(H,28,32)/b2-1+/t21-,22-/m0/s1 |
| InChIKey | CBGUZZKLPSHTPF-HNSCLNPNSA-N |
| XLogP | 0.99 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|