C23H21NO6 — CID 37242161
dimethyl 5-[2-(2,4-dimethylquinolin-3-yl)acetyl]oxybenzene-1,3-dicarboxylate (PubChem CID 37242161) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is dimethyl 5-[2-(2,4-dimethylquinolin-3-yl)acetyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-(2,4-dimethylquinolin-3-yl)acetyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 37242161 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | dimethyl 5-[2-(2,4-dimethylquinolin-3-yl)acetyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)Cc2c(C)nc3ccccc3c2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H21NO6/c1-13-18-7-5-6-8-20(18)24-14(2)19(13)12-21(25)30-17-10-15(22(26)28-3)9-16(11-17)23(27)29-4/h5-11H,12H2,1-4H3 |
| InChIKey | NRIAWRJGDYFDKC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|