C22H14F2N2O2 — CID 5127751
methyl 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylate (PubChem CID 5127751) has the molecular formula C22H14F2N2O2 and a molecular weight of 376.36 g/mol. Its IUPAC name is methyl 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylate.
| Compound Name | methyl 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 5127751 |
| Molecular Formula | C22H14F2N2O2 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | methyl 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(-c3cccc(F)c3)c(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C22H14F2N2O2/c1-28-22(27)15-8-9-18-19(12-15)26-21(14-5-3-7-17(24)11-14)20(25-18)13-4-2-6-16(23)10-13/h2-12H,1H3 |
| InChIKey | DHDHQCSADURXGA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |