2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid

C21H12F2N2O2 — CID 5127746

IUPAC2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3cccc(F)c3)c(-c3cccc(F)c3)nc2c1
InChIInChI=1S/C21H12F2N2O2/c22-15-5-1-3-12(9-15)19-20(13-4-2-6-16(23)10-13)25-18-11-14(21(26)27)7-8-17(18)24-19/h1-11H,(H,26,27)
InChIKeyYLXOKMPPDOHQPB-UHFFFAOYSA-N
MW362.34 g/mol
LogP4.94
Rot. Bonds3

About 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid

2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid (PubChem CID 5127746) has the molecular formula C21H12F2N2O2 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid.

Molecular Properties

Compound Name2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid
PubChem CID5127746
Molecular FormulaC21H12F2N2O2
Molecular Weight362.34 g/mol
Exact Mass362.09
IUPAC Name2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid
SMILESO=C(O)c1ccc2nc(-c3cccc(F)c3)c(-c3cccc(F)c3)nc2c1
InChIInChI=1S/C21H12F2N2O2/c22-15-5-1-3-12(9-15)19-20(13-4-2-6-16(23)10-13)25-18-11-14(21(26)27)7-8-17(18)24-19/h1-11H,(H,26,27)
InChIKeyYLXOKMPPDOHQPB-UHFFFAOYSA-N
XLogP4.94
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.34
LogP ≤ 54.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid?
The IUPAC name of 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid (CID 5127746) is 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid.
What is the SMILES notation for 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid?
The canonical SMILES for 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid is O=C(O)c1ccc2nc(-c3cccc(F)c3)c(-c3cccc(F)c3)nc2c1.
What is the InChIKey of 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid?
The InChIKey is YLXOKMPPDOHQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12F2N2O2/c22-15-5-1-3-12(9-15)19-20(13-4-2-6-16(23)10-13)25-18-11-14(21(26)27)7-8-17(18)24-19/h1-11H,(H,26,27).
What are the key properties of 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid?
2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid has a molecular weight of 362.34 g/mol, XLogP of 4.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid is sourced from PubChem (CID 5127746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).