C21H12F2N2O2 — CID 5127746
2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid (PubChem CID 5127746) has the molecular formula C21H12F2N2O2 and a molecular weight of 362.34 g/mol. Its IUPAC name is 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid.
| Compound Name | 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 5127746 |
| Molecular Formula | C21H12F2N2O2 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2,3-bis(3-fluorophenyl)quinoxaline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3cccc(F)c3)c(-c3cccc(F)c3)nc2c1 |
| InChI | InChI=1S/C21H12F2N2O2/c22-15-5-1-3-12(9-15)19-20(13-4-2-6-16(23)10-13)25-18-11-14(21(26)27)7-8-17(18)24-19/h1-11H,(H,26,27) |
| InChIKey | YLXOKMPPDOHQPB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |