C27H18N2O6 — CID 10073215
2,3-bis[4-[(E)-2-carboxyethenyl]phenyl]quinoxaline-6-carboxylic acid (PubChem CID 10073215) has the molecular formula C27H18N2O6 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2,3-bis[4-[(E)-2-carboxyethenyl]phenyl]quinoxaline-6-carboxylic acid.
| Compound Name | 2,3-bis[4-[(E)-2-carboxyethenyl]phenyl]quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 10073215 |
| Molecular Formula | C27H18N2O6 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2,3-bis[4-[(E)-2-carboxyethenyl]phenyl]quinoxaline-6-carboxylic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2nc3ccc(C(=O)O)cc3nc2-c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H18N2O6/c30-23(31)13-5-16-1-7-18(8-2-16)25-26(19-9-3-17(4-10-19)6-14-24(32)33)29-22-15-20(27(34)35)11-12-21(22)28-25/h1-15H,(H,30,31)(H,32,33)(H,34,35)/b13-5+,14-6+ |
| InChIKey | KYFYKBBLANNORX-ACFHMISVSA-N |
| XLogP | 4.86 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|