C11H8O6 — CID 10466624
5-[(E)-2-carboxyethenyl]benzene-1,3-dicarboxylic acid (PubChem CID 10466624) has the molecular formula C11H8O6 and a molecular weight of 236.18 g/mol. Its IUPAC name is 5-[(E)-2-carboxyethenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(E)-2-carboxyethenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 10466624 |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 5-[(E)-2-carboxyethenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)/C=C/c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H8O6/c12-9(13)2-1-6-3-7(10(14)15)5-8(4-6)11(16)17/h1-5H,(H,12,13)(H,14,15)(H,16,17)/b2-1+ |
| InChIKey | AZTXPCQVSWQMKH-OWOJBTEDSA-N |
| XLogP | 1.18 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|