C14H8Cl2O4S — CID 139761806
3-[(E)-2-carboxyethenyl]-5-(2,5-dichlorothiophen-3-yl)benzoic acid (PubChem CID 139761806) has the molecular formula C14H8Cl2O4S and a molecular weight of 343.19 g/mol. Its IUPAC name is 3-[(E)-2-carboxyethenyl]-5-(2,5-dichlorothiophen-3-yl)benzoic acid.
| Compound Name | 3-[(E)-2-carboxyethenyl]-5-(2,5-dichlorothiophen-3-yl)benzoic acid |
|---|---|
| PubChem CID | 139761806 |
| Molecular Formula | C14H8Cl2O4S |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 341.95 |
| IUPAC Name | 3-[(E)-2-carboxyethenyl]-5-(2,5-dichlorothiophen-3-yl)benzoic acid |
| SMILES | O=C(O)/C=C/c1cc(C(=O)O)cc(-c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl2O4S/c15-11-6-10(13(16)21-11)8-3-7(1-2-12(17)18)4-9(5-8)14(19)20/h1-6H,(H,17,18)(H,19,20)/b2-1+ |
| InChIKey | RPKMILPYOZOEBR-OWOJBTEDSA-N |
| XLogP | 4.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|