C13H9Cl2NO3S2 — CID 107965531
(E)-3-[5-[[(2,5-dichlorothiophene-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 107965531) has the molecular formula C13H9Cl2NO3S2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (E)-3-[5-[[(2,5-dichlorothiophene-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(2,5-dichlorothiophene-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107965531 |
| Molecular Formula | C13H9Cl2NO3S2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | (E)-3-[5-[[(2,5-dichlorothiophene-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(CNC(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO3S2/c14-10-4-9(12(15)21-10)13(19)16-5-8-3-7(6-20-8)1-2-11(17)18/h1-4,6H,5H2,(H,16,19)(H,17,18)/b2-1+ |
| InChIKey | IATAEFGZZWSZAP-OWOJBTEDSA-N |
| XLogP | 4.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|