C14H12ClNO3S2 — CID 76938209
3-[5-[[(5-chlorothiophene-2-carbonyl)-methylamino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76938209) has the molecular formula C14H12ClNO3S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-[5-[[(5-chlorothiophene-2-carbonyl)-methylamino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[(5-chlorothiophene-2-carbonyl)-methylamino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76938209 |
| Molecular Formula | C14H12ClNO3S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 3-[5-[[(5-chlorothiophene-2-carbonyl)-methylamino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CN(Cc1cc(C=CC(=O)O)cs1)C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H12ClNO3S2/c1-16(14(19)11-3-4-12(15)21-11)7-10-6-9(8-20-10)2-5-13(17)18/h2-6,8H,7H2,1H3,(H,17,18) |
| InChIKey | FQOCCHSRUIAKNI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|