C12H17NO3S — CID 76918722
3-[5-[[ethyl(2-hydroxyethyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76918722) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-[5-[[ethyl(2-hydroxyethyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[ethyl(2-hydroxyethyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918722 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-[5-[[ethyl(2-hydroxyethyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CCN(CCO)Cc1cc(C=CC(=O)O)cs1 |
| InChI | InChI=1S/C12H17NO3S/c1-2-13(5-6-14)8-11-7-10(9-17-11)3-4-12(15)16/h3-4,7,9,14H,2,5-6,8H2,1H3,(H,15,16) |
| InChIKey | FCDJSIRBIRMTSM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|