C15H24N2O2S — CID 103190755
(E)-3-[5-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 103190755) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is (E)-3-[5-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103190755 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (E)-3-[5-[[1-(dimethylamino)propan-2-yl-ethylamino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CCN(Cc1cc(/C=C/C(=O)O)cs1)C(C)CN(C)C |
| InChI | InChI=1S/C15H24N2O2S/c1-5-17(12(2)9-16(3)4)10-14-8-13(11-20-14)6-7-15(18)19/h6-8,11-12H,5,9-10H2,1-4H3,(H,18,19)/b7-6+ |
| InChIKey | WMBTYGHTPVFNCU-VOTSOKGWSA-N |
| XLogP | 2.62 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|