C14H17NO3S2 — CID 77021799
3-[5-[[methyl(thiolane-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 77021799) has the molecular formula C14H17NO3S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[5-[[methyl(thiolane-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[methyl(thiolane-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77021799 |
| Molecular Formula | C14H17NO3S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-[5-[[methyl(thiolane-3-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CN(Cc1cc(C=CC(=O)O)cs1)C(=O)C1CCSC1 |
| InChI | InChI=1S/C14H17NO3S2/c1-15(14(18)11-4-5-19-9-11)7-12-6-10(8-20-12)2-3-13(16)17/h2-3,6,8,11H,4-5,7,9H2,1H3,(H,16,17) |
| InChIKey | NJKKNBLKJKVVAM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|