C12H12F3NO3S — CID 76909962
3-[4-[[methyl(3,3,3-trifluoropropanoyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 76909962) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 3-[4-[[methyl(3,3,3-trifluoropropanoyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[4-[[methyl(3,3,3-trifluoropropanoyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76909962 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 3-[4-[[methyl(3,3,3-trifluoropropanoyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CN(Cc1csc(C=CC(=O)O)c1)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3S/c1-16(10(17)5-12(13,14)15)6-8-4-9(20-7-8)2-3-11(18)19/h2-4,7H,5-6H2,1H3,(H,18,19) |
| InChIKey | BZAAYLZTIZMQMO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|