C13H13N3O3S2 — CID 77059672
3-[5-[[(4-ethylthiadiazole-5-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 77059672) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[5-[[(4-ethylthiadiazole-5-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[(4-ethylthiadiazole-5-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77059672 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-[5-[[(4-ethylthiadiazole-5-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CCc1nnsc1C(=O)NCc1cc(C=CC(=O)O)cs1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-2-10-12(21-16-15-10)13(19)14-6-9-5-8(7-20-9)3-4-11(17)18/h3-5,7H,2,6H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | DXORLCULFWYJJW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|