C14H11FN2O3S — CID 104639583
(E)-3-[5-[[(5-fluoropyridine-2-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 104639583) has the molecular formula C14H11FN2O3S and a molecular weight of 306.32 g/mol. Its IUPAC name is (E)-3-[5-[[(5-fluoropyridine-2-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(5-fluoropyridine-2-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104639583 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (E)-3-[5-[[(5-fluoropyridine-2-carbonyl)amino]methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(CNC(=O)c2ccc(F)cn2)c1 |
| InChI | InChI=1S/C14H11FN2O3S/c15-10-2-3-12(16-6-10)14(20)17-7-11-5-9(8-21-11)1-4-13(18)19/h1-6,8H,7H2,(H,17,20)(H,18,19)/b4-1+ |
| InChIKey | SXSXOCGETCZYIG-DAFODLJHSA-N |
| XLogP | 2.31 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|