C14H11FN2O3 — CID 104638128
4-[[(5-fluoropyridine-2-carbonyl)amino]methyl]benzoic acid (PubChem CID 104638128) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is 4-[[(5-fluoropyridine-2-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(5-fluoropyridine-2-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 104638128 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-[[(5-fluoropyridine-2-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccc(F)cn2)cc1 |
| InChI | InChI=1S/C14H11FN2O3/c15-11-5-6-12(16-8-11)13(18)17-7-9-1-3-10(4-2-9)14(19)20/h1-6,8H,7H2,(H,17,18)(H,19,20) |
| InChIKey | ZBMXTTSPFDFTSA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |