C14H12FN3O3 — CID 44540008
5-N-[(4-fluorophenyl)methyl]-2-N-hydroxypyridine-2,5-dicarboxamide (PubChem CID 44540008) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 5-N-[(4-fluorophenyl)methyl]-2-N-hydroxypyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[(4-fluorophenyl)methyl]-2-N-hydroxypyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 44540008 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-N-[(4-fluorophenyl)methyl]-2-N-hydroxypyridine-2,5-dicarboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(C(=O)NO)nc1 |
| InChI | InChI=1S/C14H12FN3O3/c15-11-4-1-9(2-5-11)7-17-13(19)10-3-6-12(16-8-10)14(20)18-21/h1-6,8,21H,7H2,(H,17,19)(H,18,20) |
| InChIKey | AGGKAUIDKBSVAX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|