C11H10F2N2O3 — CID 115408483
(E)-3-[6-(2,2-difluoroethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 115408483) has the molecular formula C11H10F2N2O3 and a molecular weight of 256.21 g/mol. Its IUPAC name is (E)-3-[6-(2,2-difluoroethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-(2,2-difluoroethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115408483 |
| Molecular Formula | C11H10F2N2O3 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (E)-3-[6-(2,2-difluoroethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)NCC(F)F)nc1 |
| InChI | InChI=1S/C11H10F2N2O3/c12-9(13)6-15-11(18)8-3-1-7(5-14-8)2-4-10(16)17/h1-5,9H,6H2,(H,15,18)(H,16,17)/b4-2+ |
| InChIKey | HMZJXZUYJRDTRN-DUXPYHPUSA-N |
| XLogP | 1.17 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|