C14H17N3O4 — CID 76978642
3-[6-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 76978642) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-[6-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76978642 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3-[6-[[2-oxo-2-(propan-2-ylamino)ethyl]carbamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C)NC(=O)CNC(=O)c1ccc(C=CC(=O)O)cn1 |
| InChI | InChI=1S/C14H17N3O4/c1-9(2)17-12(18)8-16-14(21)11-5-3-10(7-15-11)4-6-13(19)20/h3-7,9H,8H2,1-2H3,(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | QBHIVNULVAGQMG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|