C14H13N3O4 — CID 106376541
(E)-3-[6-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 106376541) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is (E)-3-[6-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106376541 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (E)-3-[6-[(5-methyl-1,3-oxazol-2-yl)methylcarbamoyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cnc(CNC(=O)c2ccc(/C=C/C(=O)O)cn2)o1 |
| InChI | InChI=1S/C14H13N3O4/c1-9-6-16-12(21-9)8-17-14(20)11-4-2-10(7-15-11)3-5-13(18)19/h2-7H,8H2,1H3,(H,17,20)(H,18,19)/b5-3+ |
| InChIKey | PMKRWANMNMUVKT-HWKANZROSA-N |
| XLogP | 1.41 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|