C14H14N4O3 — CID 76978837
3-[6-(2-pyrazol-1-ylethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 76978837) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 3-[6-(2-pyrazol-1-ylethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-(2-pyrazol-1-ylethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76978837 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[6-(2-pyrazol-1-ylethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=O)NCCn2cccn2)nc1 |
| InChI | InChI=1S/C14H14N4O3/c19-13(20)5-3-11-2-4-12(16-10-11)14(21)15-7-9-18-8-1-6-17-18/h1-6,8,10H,7,9H2,(H,15,21)(H,19,20) |
| InChIKey | NYFMVOLIEUMROR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|