C13H11N3O3S — CID 77033765
3-[5-[(pyrazine-2-carbonylamino)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 77033765) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 3-[5-[(pyrazine-2-carbonylamino)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(pyrazine-2-carbonylamino)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77033765 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3-[5-[(pyrazine-2-carbonylamino)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(CNC(=O)c2cnccn2)c1 |
| InChI | InChI=1S/C13H11N3O3S/c17-12(18)2-1-9-5-10(20-8-9)6-16-13(19)11-7-14-3-4-15-11/h1-5,7-8H,6H2,(H,16,19)(H,17,18) |
| InChIKey | NSYPYUGBAOQTAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|