C26H18O8 — CID 5246292
5-[2-[4-[2-(3,5-dicarboxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,3-dicarboxylic acid (PubChem CID 5246292) has the molecular formula C26H18O8 and a molecular weight of 458.42 g/mol. Its IUPAC name is 5-[2-[4-[2-(3,5-dicarboxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-[4-[2-(3,5-dicarboxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 5246292 |
| Molecular Formula | C26H18O8 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 5-[2-[4-[2-(3,5-dicarboxyphenyl)ethenyl]phenyl]ethenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C=Cc2ccc(C=Cc3cc(C(=O)O)cc(C(=O)O)c3)cc2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C26H18O8/c27-23(28)19-9-17(10-20(13-19)24(29)30)7-5-15-1-2-16(4-3-15)6-8-18-11-21(25(31)32)14-22(12-18)26(33)34/h1-14H,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | ZOIOTZAGTZSLCZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|