C27H19N5O3 — CID 1330020
methyl 4-[(2,3-dipyridin-2-ylquinoxaline-6-carbonyl)amino]benzoate (PubChem CID 1330020) has the molecular formula C27H19N5O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is methyl 4-[(2,3-dipyridin-2-ylquinoxaline-6-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(2,3-dipyridin-2-ylquinoxaline-6-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 1330020 |
| Molecular Formula | C27H19N5O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | methyl 4-[(2,3-dipyridin-2-ylquinoxaline-6-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc3nc(-c4ccccn4)c(-c4ccccn4)nc3c2)cc1 |
| InChI | InChI=1S/C27H19N5O3/c1-35-27(34)17-8-11-19(12-9-17)30-26(33)18-10-13-20-23(16-18)32-25(22-7-3-5-15-29-22)24(31-20)21-6-2-4-14-28-21/h2-16H,1H3,(H,30,33) |
| InChIKey | ZJELOVSHFWXJQL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |