C25H16N4O — CID 54672430
(2,3-dipyridin-2-ylquinoxalin-6-yl)-phenylmethanone (PubChem CID 54672430) has the molecular formula C25H16N4O and a molecular weight of 388.43 g/mol. Its IUPAC name is (2,3-dipyridin-2-ylquinoxalin-6-yl)-phenylmethanone.
| Compound Name | (2,3-dipyridin-2-ylquinoxalin-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 54672430 |
| Molecular Formula | C25H16N4O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (2,3-dipyridin-2-ylquinoxalin-6-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc2nc(-c3ccccn3)c(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C25H16N4O/c30-25(17-8-2-1-3-9-17)18-12-13-19-22(16-18)29-24(21-11-5-7-15-27-21)23(28-19)20-10-4-6-14-26-20/h1-16H |
| InChIKey | LOMAFEQMAGJMET-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |