C19H13N3O — CID 163207383
phenyl-(1-pyridin-2-ylimidazo[1,5-a]pyridin-3-yl)methanone (PubChem CID 163207383) has the molecular formula C19H13N3O and a molecular weight of 299.33 g/mol. Its IUPAC name is phenyl-(1-pyridin-2-ylimidazo[1,5-a]pyridin-3-yl)methanone.
| Compound Name | phenyl-(1-pyridin-2-ylimidazo[1,5-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 163207383 |
| Molecular Formula | C19H13N3O |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | phenyl-(1-pyridin-2-ylimidazo[1,5-a]pyridin-3-yl)methanone |
| SMILES | O=C(c1ccccc1)c1nc(-c2ccccn2)c2ccccn12 |
| InChI | InChI=1S/C19H13N3O/c23-18(14-8-2-1-3-9-14)19-21-17(15-10-4-6-12-20-15)16-11-5-7-13-22(16)19/h1-13H |
| InChIKey | JQPDZIFUIGLTBG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |