methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate

C22H16N2O3 — CID 163207395

IUPACmethyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate
SMILESCOC(=O)c1ccc(C(=O)c2nc(-c3ccccc3)c3ccccn23)cc1
InChIInChI=1S/C22H16N2O3/c1-27-22(26)17-12-10-16(11-13-17)20(25)21-23-19(15-7-3-2-4-8-15)18-9-5-6-14-24(18)21/h2-14H,1H3
InChIKeyJNDIDEDVMRVBOO-UHFFFAOYSA-N
MW356.38 g/mol
LogP4.02
Rot. Bonds4

About methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate

methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate (PubChem CID 163207395) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate.

Molecular Properties

Compound Namemethyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate
PubChem CID163207395
Molecular FormulaC22H16N2O3
Molecular Weight356.38 g/mol
Exact Mass356.12
IUPAC Namemethyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate
SMILESCOC(=O)c1ccc(C(=O)c2nc(-c3ccccc3)c3ccccn23)cc1
InChIInChI=1S/C22H16N2O3/c1-27-22(26)17-12-10-16(11-13-17)20(25)21-23-19(15-7-3-2-4-8-15)18-9-5-6-14-24(18)21/h2-14H,1H3
InChIKeyJNDIDEDVMRVBOO-UHFFFAOYSA-N
XLogP4.02
TPSA60.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.38
LogP ≤ 54.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate?
The IUPAC name of methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate (CID 163207395) is methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate.
What is the SMILES notation for methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate?
The canonical SMILES for methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate is COC(=O)c1ccc(C(=O)c2nc(-c3ccccc3)c3ccccn23)cc1.
What is the InChIKey of methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate?
The InChIKey is JNDIDEDVMRVBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O3/c1-27-22(26)17-12-10-16(11-13-17)20(25)21-23-19(15-7-3-2-4-8-15)18-9-5-6-14-24(18)21/h2-14H,1H3.
What are the key properties of methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate?
methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate has a molecular weight of 356.38 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate is sourced from PubChem (CID 163207395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).