C22H16N2O3 — CID 163207395
methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate (PubChem CID 163207395) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate.
| Compound Name | methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate |
|---|---|
| PubChem CID | 163207395 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methyl 4-(1-phenylimidazo[1,5-a]pyridine-3-carbonyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)c2nc(-c3ccccc3)c3ccccn23)cc1 |
| InChI | InChI=1S/C22H16N2O3/c1-27-22(26)17-12-10-16(11-13-17)20(25)21-23-19(15-7-3-2-4-8-15)18-9-5-6-14-24(18)21/h2-14H,1H3 |
| InChIKey | JNDIDEDVMRVBOO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |