C27H20N2O2 — CID 21178049
[3-(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl] 4-methylbenzoate (PubChem CID 21178049) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [3-(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl] 4-methylbenzoate.
| Compound Name | [3-(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 21178049 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [3-(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(-c3nc(-c4ccccc4)c4ccccn34)c2)cc1 |
| InChI | InChI=1S/C27H20N2O2/c1-19-13-15-21(16-14-19)27(30)31-23-11-7-10-22(18-23)26-28-25(20-8-3-2-4-9-20)24-12-5-6-17-29(24)26/h2-18H,1H3 |
| InChIKey | XYBSVEHSARZESM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|