C45H30N6 — CID 132506865
3-[3,5-bis(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl]-1-phenylimidazo[1,5-a]pyridine (PubChem CID 132506865) has the molecular formula C45H30N6 and a molecular weight of 654.78 g/mol. Its IUPAC name is 3-[3,5-bis(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl]-1-phenylimidazo[1,5-a]pyridine.
| Compound Name | 3-[3,5-bis(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl]-1-phenylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 132506865 |
| Molecular Formula | C45H30N6 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 3-[3,5-bis(1-phenylimidazo[1,5-a]pyridin-3-yl)phenyl]-1-phenylimidazo[1,5-a]pyridine |
| SMILES | c1ccc(-c2nc(-c3cc(-c4nc(-c5ccccc5)c5ccccn45)cc(-c4nc(-c5ccccc5)c5ccccn45)c3)n3ccccc23)cc1 |
| InChI | InChI=1S/C45H30N6/c1-4-16-31(17-5-1)40-37-22-10-13-25-49(37)43(46-40)34-28-35(44-47-41(32-18-6-2-7-19-32)38-23-11-14-26-50(38)44)30-36(29-34)45-48-42(33-20-8-3-9-21-33)39-24-12-15-27-51(39)45/h1-30H |
| InChIKey | WKQKIQSDXCXCHO-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 51.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |