C19H13N3O2 — CID 154641480
3-(2-nitrophenyl)-1-phenylimidazo[1,5-a]pyridine (PubChem CID 154641480) has the molecular formula C19H13N3O2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-1-phenylimidazo[1,5-a]pyridine.
| Compound Name | 3-(2-nitrophenyl)-1-phenylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 154641480 |
| Molecular Formula | C19H13N3O2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-(2-nitrophenyl)-1-phenylimidazo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1-c1nc(-c2ccccc2)c2ccccn12 |
| InChI | InChI=1S/C19H13N3O2/c23-22(24)16-11-5-4-10-15(16)19-20-18(14-8-2-1-3-9-14)17-12-6-7-13-21(17)19/h1-13H |
| InChIKey | ZMWIINZPDFRHMO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|